C21H23F2N3O2 — CID 25282901
2-[[[(1S)-1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethyl]amino]methyl]-6-ethoxyphenol (PubChem CID 25282901) has the molecular formula C21H23F2N3O2 and a molecular weight of 387.43 g/mol. Its IUPAC name is 2-[[[(1S)-1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethyl]amino]methyl]-6-ethoxyphenol.
| Compound Name | 2-[[[(1S)-1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethyl]amino]methyl]-6-ethoxyphenol |
|---|---|
| PubChem CID | 25282901 |
| Molecular Formula | C21H23F2N3O2 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 2-[[[(1S)-1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethyl]amino]methyl]-6-ethoxyphenol |
| SMILES | CCOc1cccc(CN[C@@H](C)c2cnn(-c3ccc(F)cc3F)c2C)c1O |
| InChI | InChI=1S/C21H23F2N3O2/c1-4-28-20-7-5-6-15(21(20)27)11-24-13(2)17-12-25-26(14(17)3)19-9-8-16(22)10-18(19)23/h5-10,12-13,24,27H,4,11H2,1-3H3/t13-/m0/s1 |
| InChIKey | KZTZVHAGELUEQL-ZDUSSCGKSA-N |
| XLogP | 4.41 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|