C16H18ClN3O3S — CID 25285402
[5-[(2-chloro-4-methoxyphenoxy)methyl]-1H-pyrazol-3-yl]-thiomorpholin-4-ylmethanone (PubChem CID 25285402) has the molecular formula C16H18ClN3O3S and a molecular weight of 367.86 g/mol. Its IUPAC name is [5-[(2-chloro-4-methoxyphenoxy)methyl]-1H-pyrazol-3-yl]-thiomorpholin-4-ylmethanone.
| Compound Name | [5-[(2-chloro-4-methoxyphenoxy)methyl]-1H-pyrazol-3-yl]-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 25285402 |
| Molecular Formula | C16H18ClN3O3S |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | [5-[(2-chloro-4-methoxyphenoxy)methyl]-1H-pyrazol-3-yl]-thiomorpholin-4-ylmethanone |
| SMILES | COc1ccc(OCc2cc(C(=O)N3CCSCC3)n[nH]2)c(Cl)c1 |
| InChI | InChI=1S/C16H18ClN3O3S/c1-22-12-2-3-15(13(17)9-12)23-10-11-8-14(19-18-11)16(21)20-4-6-24-7-5-20/h2-3,8-9H,4-7,10H2,1H3,(H,18,19) |
| InChIKey | JCYZFOUVSPSUDG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |