C31H26ClN3O — CID 25285573
(2S,3R,10bR)-3-benzoyl-2-[3-(chloromethyl)-2,4,6-trimethylphenyl]-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline-1,1-dicarbonitrile (PubChem CID 25285573) has the molecular formula C31H26ClN3O and a molecular weight of 492.02 g/mol. Its IUPAC name is (2S,3R,10bR)-3-benzoyl-2-[3-(chloromethyl)-2,4,6-trimethylphenyl]-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline-1,1-dicarbonitrile.
| Compound Name | (2S,3R,10bR)-3-benzoyl-2-[3-(chloromethyl)-2,4,6-trimethylphenyl]-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline-1,1-dicarbonitrile |
|---|---|
| PubChem CID | 25285573 |
| Molecular Formula | C31H26ClN3O |
| Molecular Weight | 492.02 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | (2S,3R,10bR)-3-benzoyl-2-[3-(chloromethyl)-2,4,6-trimethylphenyl]-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline-1,1-dicarbonitrile |
| SMILES | Cc1cc(C)c([C@@H]2[C@H](C(=O)c3ccccc3)N3C=Cc4ccccc4[C@@H]3C2(C#N)C#N)c(C)c1CCl |
| InChI | InChI=1S/C31H26ClN3O/c1-19-15-20(2)26(21(3)25(19)16-32)27-28(29(36)23-10-5-4-6-11-23)35-14-13-22-9-7-8-12-24(22)30(35)31(27,17-33)18-34/h4-15,27-28,30H,16H2,1-3H3/t27-,28-,30-/m1/s1 |
| InChIKey | DRMNCDXWRFSVIO-MUPNOLHXSA-N |
| XLogP | 6.76 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.02 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|