C18H17N3OS — CID 25285777
N-[[5-(1-benzofuran-2-yl)-1H-pyrazol-4-yl]methyl]-2-thiophen-2-ylethanamine (PubChem CID 25285777) has the molecular formula C18H17N3OS and a molecular weight of 323.42 g/mol. Its IUPAC name is N-[[5-(1-benzofuran-2-yl)-1H-pyrazol-4-yl]methyl]-2-thiophen-2-ylethanamine.
| Compound Name | N-[[5-(1-benzofuran-2-yl)-1H-pyrazol-4-yl]methyl]-2-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 25285777 |
| Molecular Formula | C18H17N3OS |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | N-[[5-(1-benzofuran-2-yl)-1H-pyrazol-4-yl]methyl]-2-thiophen-2-ylethanamine |
| SMILES | c1csc(CCNCc2cn[nH]c2-c2cc3ccccc3o2)c1 |
| InChI | InChI=1S/C18H17N3OS/c1-2-6-16-13(4-1)10-17(22-16)18-14(12-20-21-18)11-19-8-7-15-5-3-9-23-15/h1-6,9-10,12,19H,7-8,11H2,(H,20,21) |
| InChIKey | YVWNGKGPVXLVMH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|