C28H39NO3S — CID 25286257
N-[[(1R,4aR,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-4-methoxy-3-methylbenzenesulfonamide (PubChem CID 25286257) has the molecular formula C28H39NO3S and a molecular weight of 469.69 g/mol. Its IUPAC name is N-[[(1R,4aR,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-4-methoxy-3-methylbenzenesulfonamide.
| Compound Name | N-[[(1R,4aR,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-4-methoxy-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 25286257 |
| Molecular Formula | C28H39NO3S |
| Molecular Weight | 469.69 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | N-[[(1R,4aR,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-4-methoxy-3-methylbenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC[C@]2(C)CCC[C@@]3(C)c4ccc(C(C)C)cc4CC[C@H]23)cc1C |
| InChI | InChI=1S/C28H39NO3S/c1-19(2)21-8-11-24-22(17-21)9-13-26-27(4,14-7-15-28(24,26)5)18-29-33(30,31)23-10-12-25(32-6)20(3)16-23/h8,10-12,16-17,19,26,29H,7,9,13-15,18H2,1-6H3/t26-,27+,28+/m1/s1 |
| InChIKey | IOFATHVLOIXNOR-PKTNWEFCSA-N |
| XLogP | 6.12 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.69 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |