C16H16N6O2S — CID 25286477
methyl 3-[[N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]amino]thieno[2,3-b]pyridine-2-carboxylate (PubChem CID 25286477) has the molecular formula C16H16N6O2S and a molecular weight of 356.41 g/mol. Its IUPAC name is methyl 3-[[N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]amino]thieno[2,3-b]pyridine-2-carboxylate.
| Compound Name | methyl 3-[[N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]amino]thieno[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 25286477 |
| Molecular Formula | C16H16N6O2S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | methyl 3-[[N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]amino]thieno[2,3-b]pyridine-2-carboxylate |
| SMILES | COC(=O)c1sc2ncccc2c1NC(N)=Nc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C16H16N6O2S/c1-8-7-9(2)20-16(19-8)22-15(17)21-11-10-5-4-6-18-13(10)25-12(11)14(23)24-3/h4-7H,1-3H3,(H3,17,19,20,21,22) |
| InChIKey | HKPFQFRWUXXPGC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|