C20H34N4O3S — CID 25287027
1-[(3-butyl-2-cyclohexylsulfonylimidazol-4-yl)methyl]piperidine-4-carboxamide (PubChem CID 25287027) has the molecular formula C20H34N4O3S and a molecular weight of 410.58 g/mol. Its IUPAC name is 1-[(3-butyl-2-cyclohexylsulfonylimidazol-4-yl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-[(3-butyl-2-cyclohexylsulfonylimidazol-4-yl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 25287027 |
| Molecular Formula | C20H34N4O3S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 1-[(3-butyl-2-cyclohexylsulfonylimidazol-4-yl)methyl]piperidine-4-carboxamide |
| SMILES | CCCCn1c(CN2CCC(C(N)=O)CC2)cnc1S(=O)(=O)C1CCCCC1 |
| InChI | InChI=1S/C20H34N4O3S/c1-2-3-11-24-17(15-23-12-9-16(10-13-23)19(21)25)14-22-20(24)28(26,27)18-7-5-4-6-8-18/h14,16,18H,2-13,15H2,1H3,(H2,21,25) |
| InChIKey | AVRGJVGUVJAOEM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |