C15H16N2O4 — CID 2528825
N-(3,4,5-trimethoxyphenyl)pyridine-2-carboxamide (PubChem CID 2528825) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is N-(3,4,5-trimethoxyphenyl)pyridine-2-carboxamide.
| Compound Name | N-(3,4,5-trimethoxyphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 2528825 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | N-(3,4,5-trimethoxyphenyl)pyridine-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2ccccn2)cc(OC)c1OC |
| InChI | InChI=1S/C15H16N2O4/c1-19-12-8-10(9-13(20-2)14(12)21-3)17-15(18)11-6-4-5-7-16-11/h4-9H,1-3H3,(H,17,18) |
| InChIKey | YMXXTYCALJDPJY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |