C17H12F2N2O3 — CID 25289025
N-[[2-(3,4-difluorophenoxy)-3-pyridinyl]methyl]furan-2-carboxamide (PubChem CID 25289025) has the molecular formula C17H12F2N2O3 and a molecular weight of 330.29 g/mol. Its IUPAC name is N-[[2-(3,4-difluorophenoxy)-3-pyridinyl]methyl]furan-2-carboxamide.
| Compound Name | N-[[2-(3,4-difluorophenoxy)-3-pyridinyl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 25289025 |
| Molecular Formula | C17H12F2N2O3 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | N-[[2-(3,4-difluorophenoxy)-3-pyridinyl]methyl]furan-2-carboxamide |
| SMILES | O=C(NCc1cccnc1Oc1ccc(F)c(F)c1)c1ccco1 |
| InChI | InChI=1S/C17H12F2N2O3/c18-13-6-5-12(9-14(13)19)24-17-11(3-1-7-20-17)10-21-16(22)15-4-2-8-23-15/h1-9H,10H2,(H,21,22) |
| InChIKey | GGXTZEAJRMKJIL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |