C24H20FN3O4 — CID 25291244
methyl 3-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]-5-[(pyridine-2-carbonylamino)methyl]benzoate (PubChem CID 25291244) has the molecular formula C24H20FN3O4 and a molecular weight of 433.44 g/mol. Its IUPAC name is methyl 3-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]-5-[(pyridine-2-carbonylamino)methyl]benzoate.
| Compound Name | methyl 3-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]-5-[(pyridine-2-carbonylamino)methyl]benzoate |
|---|---|
| PubChem CID | 25291244 |
| Molecular Formula | C24H20FN3O4 |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | methyl 3-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]-5-[(pyridine-2-carbonylamino)methyl]benzoate |
| SMILES | COC(=O)c1cc(CNC(=O)c2ccccn2)cc(NC(=O)/C=C/c2cccc(F)c2)c1 |
| InChI | InChI=1S/C24H20FN3O4/c1-32-24(31)18-11-17(15-27-23(30)21-7-2-3-10-26-21)13-20(14-18)28-22(29)9-8-16-5-4-6-19(25)12-16/h2-14H,15H2,1H3,(H,27,30)(H,28,29)/b9-8+ |
| InChIKey | DOHURYDMZSALEG-CMDGGOBGSA-N |
| XLogP | 3.59 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|