About ethyl (3R)-3-benzyl-1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidine-3-carboxylate
ethyl (3R)-3-benzyl-1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidine-3-carboxylate (PubChem CID 25291743) has the molecular formula C20H27N3O4S
and a molecular weight of 405.52 g/mol. Its IUPAC name is ethyl (3R)-3-benzyl-1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl (3R)-3-benzyl-1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidine-3-carboxylate |
| PubChem CID | 25291743 |
| Molecular Formula | C20H27N3O4S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | ethyl (3R)-3-benzyl-1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@]1(Cc2ccccc2)CCCN(S(=O)(=O)c2c(C)n[nH]c2C)C1 |
| InChI | InChI=1S/C20H27N3O4S/c1-4-27-19(24)20(13-17-9-6-5-7-10-17)11-8-12-23(14-20)28(25,26)18-15(2)21-22-16(18)3/h5-7,9-10H,4,8,11-14H2,1-3H3,(H,21,22)/t20-/m1/s1 |
| InChIKey | YYXNKGRXCBHNMU-HXUWFJFHSA-N |
| XLogP | 2.60 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl (3R)-3-benzyl-1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3R)-3-benzyl-1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidine-3-carboxylate?
The IUPAC name of ethyl (3R)-3-benzyl-1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidine-3-carboxylate (CID 25291743) is ethyl (3R)-3-benzyl-1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidine-3-carboxylate.
What is the SMILES notation for ethyl (3R)-3-benzyl-1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidine-3-carboxylate?
The canonical SMILES for ethyl (3R)-3-benzyl-1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidine-3-carboxylate is CCOC(=O)[C@@]1(Cc2ccccc2)CCCN(S(=O)(=O)c2c(C)n[nH]c2C)C1.
What is the InChIKey of ethyl (3R)-3-benzyl-1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidine-3-carboxylate?
The InChIKey is YYXNKGRXCBHNMU-HXUWFJFHSA-N. The full InChI is InChI=1S/C20H27N3O4S/c1-4-27-19(24)20(13-17-9-6-5-7-10-17)11-8-12-23(14-20)28(25,26)18-15(2)21-22-16(18)3/h5-7,9-10H,4,8,11-14H2,1-3H3,(H,21,22)/t20-/m1/s1.
What are the key properties of ethyl (3R)-3-benzyl-1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidine-3-carboxylate?
ethyl (3R)-3-benzyl-1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidine-3-carboxylate has a molecular weight of 405.52 g/mol, XLogP of 2.60, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3R)-3-benzyl-1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidine-3-carboxylate is sourced from PubChem (CID 25291743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).