C22H29N5O2 — CID 25291789
(4aR,8aS)-1-(cyclohexylmethyl)-6-(pyrazolo[1,5-a]pyrimidine-2-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 25291789) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is (4aR,8aS)-1-(cyclohexylmethyl)-6-(pyrazolo[1,5-a]pyrimidine-2-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aR,8aS)-1-(cyclohexylmethyl)-6-(pyrazolo[1,5-a]pyrimidine-2-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 25291789 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | (4aR,8aS)-1-(cyclohexylmethyl)-6-(pyrazolo[1,5-a]pyrimidine-2-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | O=C(c1cc2ncccn2n1)N1CC[C@H]2[C@H](CCC(=O)N2CC2CCCCC2)C1 |
| InChI | InChI=1S/C22H29N5O2/c28-21-8-7-17-15-25(22(29)18-13-20-23-10-4-11-27(20)24-18)12-9-19(17)26(21)14-16-5-2-1-3-6-16/h4,10-11,13,16-17,19H,1-3,5-9,12,14-15H2/t17-,19+/m1/s1 |
| InChIKey | LRUBKXRNSISXDZ-MJGOQNOKSA-N |
| XLogP | 2.76 |
| TPSA | 70.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |