C26H38N2O2 — CID 25292169
(5S)-5-[1-adamantylmethyl(methyl)amino]-1-[(4-methoxyphenyl)methyl]azepan-2-one (PubChem CID 25292169) has the molecular formula C26H38N2O2 and a molecular weight of 410.60 g/mol. Its IUPAC name is (5S)-5-[1-adamantylmethyl(methyl)amino]-1-[(4-methoxyphenyl)methyl]azepan-2-one.
| Compound Name | (5S)-5-[1-adamantylmethyl(methyl)amino]-1-[(4-methoxyphenyl)methyl]azepan-2-one |
|---|---|
| PubChem CID | 25292169 |
| Molecular Formula | C26H38N2O2 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | (5S)-5-[1-adamantylmethyl(methyl)amino]-1-[(4-methoxyphenyl)methyl]azepan-2-one |
| SMILES | COc1ccc(CN2CC[C@@H](N(C)CC34CC5CC(CC(C5)C3)C4)CCC2=O)cc1 |
| InChI | InChI=1S/C26H38N2O2/c1-27(18-26-14-20-11-21(15-26)13-22(12-20)16-26)23-5-8-25(29)28(10-9-23)17-19-3-6-24(30-2)7-4-19/h3-4,6-7,20-23H,5,8-18H2,1-2H3/t20?,21?,22?,23-,26?/m0/s1 |
| InChIKey | KVERCLHIURHGKV-JHLQHZFVSA-N |
| XLogP | 4.72 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |