About methyl 2-[butyl(methyl)sulfamoyl]-6-(3-methylbutyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate
methyl 2-[butyl(methyl)sulfamoyl]-6-(3-methylbutyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate (PubChem CID 25294059) has the molecular formula C19H32N2O4S2
and a molecular weight of 416.61 g/mol. Its IUPAC name is methyl 2-[butyl(methyl)sulfamoyl]-6-(3-methylbutyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 2-[butyl(methyl)sulfamoyl]-6-(3-methylbutyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate |
| PubChem CID | 25294059 |
| Molecular Formula | C19H32N2O4S2 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | methyl 2-[butyl(methyl)sulfamoyl]-6-(3-methylbutyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate |
| SMILES | CCCCN(C)S(=O)(=O)c1sc2c(c1C(=O)OC)CCN(CCC(C)C)C2 |
| InChI | InChI=1S/C19H32N2O4S2/c1-6-7-10-20(4)27(23,24)19-17(18(22)25-5)15-9-12-21(11-8-14(2)3)13-16(15)26-19/h14H,6-13H2,1-5H3 |
| InChIKey | JWQURZZXPPFYST-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[butyl(methyl)sulfamoyl]-6-(3-methylbutyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[butyl(methyl)sulfamoyl]-6-(3-methylbutyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate?
The IUPAC name of methyl 2-[butyl(methyl)sulfamoyl]-6-(3-methylbutyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate (CID 25294059) is methyl 2-[butyl(methyl)sulfamoyl]-6-(3-methylbutyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate.
What is the SMILES notation for methyl 2-[butyl(methyl)sulfamoyl]-6-(3-methylbutyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate?
The canonical SMILES for methyl 2-[butyl(methyl)sulfamoyl]-6-(3-methylbutyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate is CCCCN(C)S(=O)(=O)c1sc2c(c1C(=O)OC)CCN(CCC(C)C)C2.
What is the InChIKey of methyl 2-[butyl(methyl)sulfamoyl]-6-(3-methylbutyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate?
The InChIKey is JWQURZZXPPFYST-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32N2O4S2/c1-6-7-10-20(4)27(23,24)19-17(18(22)25-5)15-9-12-21(11-8-14(2)3)13-16(15)26-19/h14H,6-13H2,1-5H3.
What are the key properties of methyl 2-[butyl(methyl)sulfamoyl]-6-(3-methylbutyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate?
methyl 2-[butyl(methyl)sulfamoyl]-6-(3-methylbutyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate has a molecular weight of 416.61 g/mol, XLogP of 3.36, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[butyl(methyl)sulfamoyl]-6-(3-methylbutyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate is sourced from PubChem (CID 25294059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).