C11H10N4OS — CID 2529482
1-(2-cyanoethyl)-3-thiophen-2-ylpyrazole-4-carboxamide (PubChem CID 2529482) has the molecular formula C11H10N4OS and a molecular weight of 246.29 g/mol. Its IUPAC name is 1-(2-cyanoethyl)-3-thiophen-2-ylpyrazole-4-carboxamide.
| Compound Name | 1-(2-cyanoethyl)-3-thiophen-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 2529482 |
| Molecular Formula | C11H10N4OS |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 1-(2-cyanoethyl)-3-thiophen-2-ylpyrazole-4-carboxamide |
| SMILES | N#CCCn1cc(C(N)=O)c(-c2cccs2)n1 |
| InChI | InChI=1S/C11H10N4OS/c12-4-2-5-15-7-8(11(13)16)10(14-15)9-3-1-6-17-9/h1,3,6-7H,2,5H2,(H2,13,16) |
| InChIKey | WIWOJOGGRKHHAR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |