C13H18N2O3 — CID 2529626
N'-(cyclopentanecarbonyl)-2,5-dimethylfuran-3-carbohydrazide (PubChem CID 2529626) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is N'-(cyclopentanecarbonyl)-2,5-dimethylfuran-3-carbohydrazide.
| Compound Name | N'-(cyclopentanecarbonyl)-2,5-dimethylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 2529626 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | N'-(cyclopentanecarbonyl)-2,5-dimethylfuran-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)C2CCCC2)c(C)o1 |
| InChI | InChI=1S/C13H18N2O3/c1-8-7-11(9(2)18-8)13(17)15-14-12(16)10-5-3-4-6-10/h7,10H,3-6H2,1-2H3,(H,14,16)(H,15,17) |
| InChIKey | WQLPFSVAWDLWNE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|