C16H15N7OS — CID 25298398
5-N,5-N-dimethyl-6-N-[(4-phenyl-1,3-thiazol-5-yl)methyl]-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine (PubChem CID 25298398) has the molecular formula C16H15N7OS and a molecular weight of 353.41 g/mol. Its IUPAC name is 5-N,5-N-dimethyl-6-N-[(4-phenyl-1,3-thiazol-5-yl)methyl]-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine.
| Compound Name | 5-N,5-N-dimethyl-6-N-[(4-phenyl-1,3-thiazol-5-yl)methyl]-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
|---|---|
| PubChem CID | 25298398 |
| Molecular Formula | C16H15N7OS |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 5-N,5-N-dimethyl-6-N-[(4-phenyl-1,3-thiazol-5-yl)methyl]-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
| SMILES | CN(C)c1nc2nonc2nc1NCc1scnc1-c1ccccc1 |
| InChI | InChI=1S/C16H15N7OS/c1-23(2)16-15(19-13-14(20-16)22-24-21-13)17-8-11-12(18-9-25-11)10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3,(H,17,19,21) |
| InChIKey | SCKDIIJHALIMQY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |