C24H31ClN2O4 — CID 25299037
3-[(3R)-1-[(5-chloro-2-hydroxyphenyl)methyl]piperidin-3-yl]-N-[(2,4-dimethoxyphenyl)methyl]propanamide (PubChem CID 25299037) has the molecular formula C24H31ClN2O4 and a molecular weight of 446.98 g/mol. Its IUPAC name is 3-[(3R)-1-[(5-chloro-2-hydroxyphenyl)methyl]piperidin-3-yl]-N-[(2,4-dimethoxyphenyl)methyl]propanamide.
| Compound Name | 3-[(3R)-1-[(5-chloro-2-hydroxyphenyl)methyl]piperidin-3-yl]-N-[(2,4-dimethoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 25299037 |
| Molecular Formula | C24H31ClN2O4 |
| Molecular Weight | 446.98 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 3-[(3R)-1-[(5-chloro-2-hydroxyphenyl)methyl]piperidin-3-yl]-N-[(2,4-dimethoxyphenyl)methyl]propanamide |
| SMILES | COc1ccc(CNC(=O)CC[C@H]2CCCN(Cc3cc(Cl)ccc3O)C2)c(OC)c1 |
| InChI | InChI=1S/C24H31ClN2O4/c1-30-21-8-6-18(23(13-21)31-2)14-26-24(29)10-5-17-4-3-11-27(15-17)16-19-12-20(25)7-9-22(19)28/h6-9,12-13,17,28H,3-5,10-11,14-16H2,1-2H3,(H,26,29)/t17-/m1/s1 |
| InChIKey | AOPSPADCEICVIV-QGZVFWFLSA-N |
| XLogP | 4.37 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.98 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|