C25H26N6O2S2 — CID 25300870
(3S)-2'-amino-5,7',7'-trimethyl-2,5'-dioxo-1'-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)spiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carbonitrile (PubChem CID 25300870) has the molecular formula C25H26N6O2S2 and a molecular weight of 506.66 g/mol. Its IUPAC name is (3S)-2'-amino-5,7',7'-trimethyl-2,5'-dioxo-1'-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)spiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carbonitrile.
| Compound Name | (3S)-2'-amino-5,7',7'-trimethyl-2,5'-dioxo-1'-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)spiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carbonitrile |
|---|---|
| PubChem CID | 25300870 |
| Molecular Formula | C25H26N6O2S2 |
| Molecular Weight | 506.66 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | (3S)-2'-amino-5,7',7'-trimethyl-2,5'-dioxo-1'-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)spiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carbonitrile |
| SMILES | Cc1ccc2c(c1)[C@]1(C(=O)N2)C(C#N)=C(N)N(c2nnc(SC(C)C)s2)C2=C1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C25H26N6O2S2/c1-12(2)34-23-30-29-22(35-23)31-17-9-24(4,5)10-18(32)19(17)25(15(11-26)20(31)27)14-8-13(3)6-7-16(14)28-21(25)33/h6-8,12H,9-10,27H2,1-5H3,(H,28,33)/t25-/m0/s1 |
| InChIKey | GQWCEVQDGNXWCB-VWLOTQADSA-N |
| XLogP | 4.39 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.66 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |