C21H24FN3O4S3 — CID 25301957
N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide (PubChem CID 25301957) has the molecular formula C21H24FN3O4S3 and a molecular weight of 497.64 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 25301957 |
| Molecular Formula | C21H24FN3O4S3 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
| SMILES | CCOCCn1/c(=N/C(=O)C2CCN(S(=O)(=O)c3cccs3)CC2)sc2cccc(F)c21 |
| InChI | InChI=1S/C21H24FN3O4S3/c1-2-29-13-12-25-19-16(22)5-3-6-17(19)31-21(25)23-20(26)15-8-10-24(11-9-15)32(27,28)18-7-4-14-30-18/h3-7,14-15H,2,8-13H2,1H3/b23-21- |
| InChIKey | QFSAZAJNAWLHPW-LNVKXUELSA-N |
| XLogP | 3.47 |
| TPSA | 80.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|