C18H25F3N4O2 — CID 25302720
4,4,4-trifluoro-N-[(5S)-2-[4-(hydroxymethyl)piperidin-1-yl]-5,6,7,8-tetrahydroquinazolin-5-yl]butanamide (PubChem CID 25302720) has the molecular formula C18H25F3N4O2 and a molecular weight of 386.42 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[(5S)-2-[4-(hydroxymethyl)piperidin-1-yl]-5,6,7,8-tetrahydroquinazolin-5-yl]butanamide.
| Compound Name | 4,4,4-trifluoro-N-[(5S)-2-[4-(hydroxymethyl)piperidin-1-yl]-5,6,7,8-tetrahydroquinazolin-5-yl]butanamide |
|---|---|
| PubChem CID | 25302720 |
| Molecular Formula | C18H25F3N4O2 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 4,4,4-trifluoro-N-[(5S)-2-[4-(hydroxymethyl)piperidin-1-yl]-5,6,7,8-tetrahydroquinazolin-5-yl]butanamide |
| SMILES | O=C(CCC(F)(F)F)N[C@H]1CCCc2nc(N3CCC(CO)CC3)ncc21 |
| InChI | InChI=1S/C18H25F3N4O2/c19-18(20,21)7-4-16(27)23-14-2-1-3-15-13(14)10-22-17(24-15)25-8-5-12(11-26)6-9-25/h10,12,14,26H,1-9,11H2,(H,23,27)/t14-/m0/s1 |
| InChIKey | YYDAJLNVWWQKGH-AWEZNQCLSA-N |
| XLogP | 2.52 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |