C21H22N2O4 — CID 2530515
(5R)-3-[(5-acetyl-2-methoxyphenyl)methyl]-5-methyl-1-(4-methylphenyl)imidazolidine-2,4-dione (PubChem CID 2530515) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is (5R)-3-[(5-acetyl-2-methoxyphenyl)methyl]-5-methyl-1-(4-methylphenyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-3-[(5-acetyl-2-methoxyphenyl)methyl]-5-methyl-1-(4-methylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2530515 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | (5R)-3-[(5-acetyl-2-methoxyphenyl)methyl]-5-methyl-1-(4-methylphenyl)imidazolidine-2,4-dione |
| SMILES | COc1ccc(C(C)=O)cc1CN1C(=O)[C@@H](C)N(c2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C21H22N2O4/c1-13-5-8-18(9-6-13)23-14(2)20(25)22(21(23)26)12-17-11-16(15(3)24)7-10-19(17)27-4/h5-11,14H,12H2,1-4H3/t14-/m1/s1 |
| InChIKey | RRXQGLXKKKTTQB-CQSZACIVSA-N |
| XLogP | 3.56 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|