About 5-(trifluoromethoxy)-1,3-dihydroindol-2-one
5-(trifluoromethoxy)-1,3-dihydroindol-2-one (PubChem CID 25307163) has the molecular formula C9H6F3NO2
and a molecular weight of 217.15 g/mol. Its IUPAC name is 5-(trifluoromethoxy)-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 5-(trifluoromethoxy)-1,3-dihydroindol-2-one |
| PubChem CID | 25307163 |
| Molecular Formula | C9H6F3NO2 |
| Molecular Weight | 217.15 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 5-(trifluoromethoxy)-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(OC(F)(F)F)ccc2N1 |
| InChI | InChI=1S/C9H6F3NO2/c10-9(11,12)15-6-1-2-7-5(3-6)4-8(14)13-7/h1-3H,4H2,(H,13,14) |
| InChIKey | NJZFZLIOCDIELL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.15 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(trifluoromethoxy)-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(trifluoromethoxy)-1,3-dihydroindol-2-one?
The IUPAC name of 5-(trifluoromethoxy)-1,3-dihydroindol-2-one (CID 25307163) is 5-(trifluoromethoxy)-1,3-dihydroindol-2-one.
What is the SMILES notation for 5-(trifluoromethoxy)-1,3-dihydroindol-2-one?
The canonical SMILES for 5-(trifluoromethoxy)-1,3-dihydroindol-2-one is O=C1Cc2cc(OC(F)(F)F)ccc2N1.
What is the InChIKey of 5-(trifluoromethoxy)-1,3-dihydroindol-2-one?
The InChIKey is NJZFZLIOCDIELL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F3NO2/c10-9(11,12)15-6-1-2-7-5(3-6)4-8(14)13-7/h1-3H,4H2,(H,13,14).
What are the key properties of 5-(trifluoromethoxy)-1,3-dihydroindol-2-one?
5-(trifluoromethoxy)-1,3-dihydroindol-2-one has a molecular weight of 217.15 g/mol, XLogP of 2.08, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(trifluoromethoxy)-1,3-dihydroindol-2-one is sourced from PubChem (CID 25307163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).