C27H30N2O5S — CID 25307318
(3S)-N-[(1S)-2-(benzylamino)-2-oxo-1-thiophen-2-ylethyl]-N-(3-ethoxypropyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 25307318) has the molecular formula C27H30N2O5S and a molecular weight of 494.61 g/mol. Its IUPAC name is (3S)-N-[(1S)-2-(benzylamino)-2-oxo-1-thiophen-2-ylethyl]-N-(3-ethoxypropyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | (3S)-N-[(1S)-2-(benzylamino)-2-oxo-1-thiophen-2-ylethyl]-N-(3-ethoxypropyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 25307318 |
| Molecular Formula | C27H30N2O5S |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | (3S)-N-[(1S)-2-(benzylamino)-2-oxo-1-thiophen-2-ylethyl]-N-(3-ethoxypropyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | CCOCCCN(C(=O)[C@@H]1COc2ccccc2O1)[C@@H](C(=O)NCc1ccccc1)c1cccs1 |
| InChI | InChI=1S/C27H30N2O5S/c1-2-32-16-9-15-29(27(31)23-19-33-21-12-6-7-13-22(21)34-23)25(24-14-8-17-35-24)26(30)28-18-20-10-4-3-5-11-20/h3-8,10-14,17,23,25H,2,9,15-16,18-19H2,1H3,(H,28,30)/t23-,25+/m0/s1 |
| InChIKey | IVPOTCDYDRMZAZ-UKILVPOCSA-N |
| XLogP | 4.20 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|