C24H29ClN4O2 — CID 25308182
3-[(3R)-1-(4-chlorobenzoyl)piperidin-3-yl]-1-(4-pyridin-2-ylpiperazin-1-yl)propan-1-one (PubChem CID 25308182) has the molecular formula C24H29ClN4O2 and a molecular weight of 440.98 g/mol. Its IUPAC name is 3-[(3R)-1-(4-chlorobenzoyl)piperidin-3-yl]-1-(4-pyridin-2-ylpiperazin-1-yl)propan-1-one.
| Compound Name | 3-[(3R)-1-(4-chlorobenzoyl)piperidin-3-yl]-1-(4-pyridin-2-ylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 25308182 |
| Molecular Formula | C24H29ClN4O2 |
| Molecular Weight | 440.98 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 3-[(3R)-1-(4-chlorobenzoyl)piperidin-3-yl]-1-(4-pyridin-2-ylpiperazin-1-yl)propan-1-one |
| SMILES | O=C(CC[C@H]1CCCN(C(=O)c2ccc(Cl)cc2)C1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C24H29ClN4O2/c25-21-9-7-20(8-10-21)24(31)29-13-3-4-19(18-29)6-11-23(30)28-16-14-27(15-17-28)22-5-1-2-12-26-22/h1-2,5,7-10,12,19H,3-4,6,11,13-18H2/t19-/m1/s1 |
| InChIKey | JCPQMBKVCXWCGD-LJQANCHMSA-N |
| XLogP | 3.72 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.98 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |