About 3-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]-5-(4-methoxyphenyl)-1,2,4-triazine
3-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]-5-(4-methoxyphenyl)-1,2,4-triazine (PubChem CID 25309243) has the molecular formula C19H19ClN6O
and a molecular weight of 382.86 g/mol. Its IUPAC name is 3-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]-5-(4-methoxyphenyl)-1,2,4-triazine.
Molecular Properties
| Compound Name | 3-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]-5-(4-methoxyphenyl)-1,2,4-triazine |
| PubChem CID | 25309243 |
| Molecular Formula | C19H19ClN6O |
| Molecular Weight | 382.86 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 3-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]-5-(4-methoxyphenyl)-1,2,4-triazine |
| SMILES | COc1ccc(-c2cnnc(N3CCN(c4ccc(Cl)cn4)CC3)n2)cc1 |
| InChI | InChI=1S/C19H19ClN6O/c1-27-16-5-2-14(3-6-16)17-13-22-24-19(23-17)26-10-8-25(9-11-26)18-7-4-15(20)12-21-18/h2-7,12-13H,8-11H2,1H3 |
| InChIKey | VOMNEQZSCPHPQV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 67.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.86 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]-5-(4-methoxyphenyl)-1,2,4-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]-5-(4-methoxyphenyl)-1,2,4-triazine?
The IUPAC name of 3-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]-5-(4-methoxyphenyl)-1,2,4-triazine (CID 25309243) is 3-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]-5-(4-methoxyphenyl)-1,2,4-triazine.
What is the SMILES notation for 3-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]-5-(4-methoxyphenyl)-1,2,4-triazine?
The canonical SMILES for 3-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]-5-(4-methoxyphenyl)-1,2,4-triazine is COc1ccc(-c2cnnc(N3CCN(c4ccc(Cl)cn4)CC3)n2)cc1.
What is the InChIKey of 3-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]-5-(4-methoxyphenyl)-1,2,4-triazine?
The InChIKey is VOMNEQZSCPHPQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19ClN6O/c1-27-16-5-2-14(3-6-16)17-13-22-24-19(23-17)26-10-8-25(9-11-26)18-7-4-15(20)12-21-18/h2-7,12-13H,8-11H2,1H3.
What are the key properties of 3-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]-5-(4-methoxyphenyl)-1,2,4-triazine?
3-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]-5-(4-methoxyphenyl)-1,2,4-triazine has a molecular weight of 382.86 g/mol, XLogP of 2.92, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]-5-(4-methoxyphenyl)-1,2,4-triazine is sourced from PubChem (CID 25309243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).