C25H28N2O2S — CID 25309891
N-[3-(3-methoxyphenyl)phenyl]-1-[(5-methylthiophen-2-yl)methyl]piperidine-4-carboxamide (PubChem CID 25309891) has the molecular formula C25H28N2O2S and a molecular weight of 420.58 g/mol. Its IUPAC name is N-[3-(3-methoxyphenyl)phenyl]-1-[(5-methylthiophen-2-yl)methyl]piperidine-4-carboxamide.
| Compound Name | N-[3-(3-methoxyphenyl)phenyl]-1-[(5-methylthiophen-2-yl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 25309891 |
| Molecular Formula | C25H28N2O2S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | N-[3-(3-methoxyphenyl)phenyl]-1-[(5-methylthiophen-2-yl)methyl]piperidine-4-carboxamide |
| SMILES | COc1cccc(-c2cccc(NC(=O)C3CCN(Cc4ccc(C)s4)CC3)c2)c1 |
| InChI | InChI=1S/C25H28N2O2S/c1-18-9-10-24(30-18)17-27-13-11-19(12-14-27)25(28)26-22-7-3-5-20(15-22)21-6-4-8-23(16-21)29-2/h3-10,15-16,19H,11-14,17H2,1-2H3,(H,26,28) |
| InChIKey | XYIFIYLHPZCVCH-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |