About 2-[(3R,4S)-3-[2-(diethylamino)ethyl]-1-(propan-2-ylcarbamoyl)piperidin-4-yl]acetic acid
2-[(3R,4S)-3-[2-(diethylamino)ethyl]-1-(propan-2-ylcarbamoyl)piperidin-4-yl]acetic acid (PubChem CID 25312595) has the molecular formula C17H33N3O3
and a molecular weight of 327.47 g/mol. Its IUPAC name is 2-[(3R,4S)-3-[2-(diethylamino)ethyl]-1-(propan-2-ylcarbamoyl)piperidin-4-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[(3R,4S)-3-[2-(diethylamino)ethyl]-1-(propan-2-ylcarbamoyl)piperidin-4-yl]acetic acid |
| PubChem CID | 25312595 |
| Molecular Formula | C17H33N3O3 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.25 |
| IUPAC Name | 2-[(3R,4S)-3-[2-(diethylamino)ethyl]-1-(propan-2-ylcarbamoyl)piperidin-4-yl]acetic acid |
| SMILES | CCN(CC)CC[C@H]1CN(C(=O)NC(C)C)CC[C@H]1CC(=O)O |
| InChI | InChI=1S/C17H33N3O3/c1-5-19(6-2)9-7-15-12-20(17(23)18-13(3)4)10-8-14(15)11-16(21)22/h13-15H,5-12H2,1-4H3,(H,18,23)(H,21,22)/t14-,15-/m0/s1 |
| InChIKey | OBGYFQUYTVMKJM-GJZGRUSLSA-N |
| XLogP | 2.25 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(3R,4S)-3-[2-(diethylamino)ethyl]-1-(propan-2-ylcarbamoyl)piperidin-4-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R,4S)-3-[2-(diethylamino)ethyl]-1-(propan-2-ylcarbamoyl)piperidin-4-yl]acetic acid?
The IUPAC name of 2-[(3R,4S)-3-[2-(diethylamino)ethyl]-1-(propan-2-ylcarbamoyl)piperidin-4-yl]acetic acid (CID 25312595) is 2-[(3R,4S)-3-[2-(diethylamino)ethyl]-1-(propan-2-ylcarbamoyl)piperidin-4-yl]acetic acid.
What is the SMILES notation for 2-[(3R,4S)-3-[2-(diethylamino)ethyl]-1-(propan-2-ylcarbamoyl)piperidin-4-yl]acetic acid?
The canonical SMILES for 2-[(3R,4S)-3-[2-(diethylamino)ethyl]-1-(propan-2-ylcarbamoyl)piperidin-4-yl]acetic acid is CCN(CC)CC[C@H]1CN(C(=O)NC(C)C)CC[C@H]1CC(=O)O.
What is the InChIKey of 2-[(3R,4S)-3-[2-(diethylamino)ethyl]-1-(propan-2-ylcarbamoyl)piperidin-4-yl]acetic acid?
The InChIKey is OBGYFQUYTVMKJM-GJZGRUSLSA-N. The full InChI is InChI=1S/C17H33N3O3/c1-5-19(6-2)9-7-15-12-20(17(23)18-13(3)4)10-8-14(15)11-16(21)22/h13-15H,5-12H2,1-4H3,(H,18,23)(H,21,22)/t14-,15-/m0/s1.
What are the key properties of 2-[(3R,4S)-3-[2-(diethylamino)ethyl]-1-(propan-2-ylcarbamoyl)piperidin-4-yl]acetic acid?
2-[(3R,4S)-3-[2-(diethylamino)ethyl]-1-(propan-2-ylcarbamoyl)piperidin-4-yl]acetic acid has a molecular weight of 327.47 g/mol, XLogP of 2.25, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R,4S)-3-[2-(diethylamino)ethyl]-1-(propan-2-ylcarbamoyl)piperidin-4-yl]acetic acid is sourced from PubChem (CID 25312595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).