C6H8N2S2 — CID 25312775
2-(2-methyl-1,3-thiazol-4-yl)ethanethioamide (PubChem CID 25312775) has the molecular formula C6H8N2S2 and a molecular weight of 172.28 g/mol. Its IUPAC name is 2-(2-methyl-1,3-thiazol-4-yl)ethanethioamide.
| Compound Name | 2-(2-methyl-1,3-thiazol-4-yl)ethanethioamide |
|---|---|
| PubChem CID | 25312775 |
| Molecular Formula | C6H8N2S2 |
| Molecular Weight | 172.28 g/mol |
| Exact Mass | 172.01 |
| IUPAC Name | 2-(2-methyl-1,3-thiazol-4-yl)ethanethioamide |
| SMILES | Cc1nc(CC(N)=S)cs1 |
| InChI | InChI=1S/C6H8N2S2/c1-4-8-5(3-10-4)2-6(7)9/h3H,2H2,1H3,(H2,7,9) |
| InChIKey | DIPOGENEJOSFDE-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|