C21H31N3O4 — CID 25314482
1-[(1S,2S,3S,4R,5R)-4-(4-benzylpiperidin-1-yl)-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]-3-ethylurea (PubChem CID 25314482) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is 1-[(1S,2S,3S,4R,5R)-4-(4-benzylpiperidin-1-yl)-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]-3-ethylurea.
| Compound Name | 1-[(1S,2S,3S,4R,5R)-4-(4-benzylpiperidin-1-yl)-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]-3-ethylurea |
|---|---|
| PubChem CID | 25314482 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | 1-[(1S,2S,3S,4R,5R)-4-(4-benzylpiperidin-1-yl)-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]-3-ethylurea |
| SMILES | CCNC(=O)N[C@H]1[C@H](O)[C@@H](N2CCC(Cc3ccccc3)CC2)[C@@H]2OC[C@H]1O2 |
| InChI | InChI=1S/C21H31N3O4/c1-2-22-21(26)23-17-16-13-27-20(28-16)18(19(17)25)24-10-8-15(9-11-24)12-14-6-4-3-5-7-14/h3-7,15-20,25H,2,8-13H2,1H3,(H2,22,23,26)/t16-,17-,18-,19+,20-/m1/s1 |
| InChIKey | PBQZGGAIWPZOBK-LTFPLMDUSA-N |
| XLogP | 1.11 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |