C22H28N2O4 — CID 25314682
(1S,2S,3S,4R,5R)-4-(2-methoxyethylamino)-2-[(4-phenylphenyl)methylamino]-6,8-dioxabicyclo[3.2.1]octan-3-ol (PubChem CID 25314682) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is (1S,2S,3S,4R,5R)-4-(2-methoxyethylamino)-2-[(4-phenylphenyl)methylamino]-6,8-dioxabicyclo[3.2.1]octan-3-ol.
| Compound Name | (1S,2S,3S,4R,5R)-4-(2-methoxyethylamino)-2-[(4-phenylphenyl)methylamino]-6,8-dioxabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 25314682 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | (1S,2S,3S,4R,5R)-4-(2-methoxyethylamino)-2-[(4-phenylphenyl)methylamino]-6,8-dioxabicyclo[3.2.1]octan-3-ol |
| SMILES | COCCN[C@H]1[C@@H]2OC[C@@H](O2)[C@@H](NCc2ccc(-c3ccccc3)cc2)[C@@H]1O |
| InChI | InChI=1S/C22H28N2O4/c1-26-12-11-23-20-21(25)19(18-14-27-22(20)28-18)24-13-15-7-9-17(10-8-15)16-5-3-2-4-6-16/h2-10,18-25H,11-14H2,1H3/t18-,19-,20-,21+,22-/m1/s1 |
| InChIKey | WUELVLQEKKVLLL-CSEOROSGSA-N |
| XLogP | 1.53 |
| TPSA | 71.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|