About 5-[[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]thiophene-2-sulfonamide
5-[[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]thiophene-2-sulfonamide (PubChem CID 25315799) has the molecular formula C11H12N6O2S2
and a molecular weight of 324.39 g/mol. Its IUPAC name is 5-[[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-[[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]thiophene-2-sulfonamide |
| PubChem CID | 25315799 |
| Molecular Formula | C11H12N6O2S2 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 5-[[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]thiophene-2-sulfonamide |
| SMILES | Cn1ncc2c(NCc3ccc(S(N)(=O)=O)s3)ncnc21 |
| InChI | InChI=1S/C11H12N6O2S2/c1-17-11-8(5-16-17)10(14-6-15-11)13-4-7-2-3-9(20-7)21(12,18)19/h2-3,5-6H,4H2,1H3,(H2,12,18,19)(H,13,14,15) |
| InChIKey | CDRZQDDGRLRYTP-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 5-[[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]thiophene-2-sulfonamide?
The IUPAC name of 5-[[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]thiophene-2-sulfonamide (CID 25315799) is 5-[[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]thiophene-2-sulfonamide.
What is the SMILES notation for 5-[[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]thiophene-2-sulfonamide?
The canonical SMILES for 5-[[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]thiophene-2-sulfonamide is Cn1ncc2c(NCc3ccc(S(N)(=O)=O)s3)ncnc21.
What is the InChIKey of 5-[[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]thiophene-2-sulfonamide?
The InChIKey is CDRZQDDGRLRYTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N6O2S2/c1-17-11-8(5-16-17)10(14-6-15-11)13-4-7-2-3-9(20-7)21(12,18)19/h2-3,5-6H,4H2,1H3,(H2,12,18,19)(H,13,14,15).
What are the key properties of 5-[[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]thiophene-2-sulfonamide?
5-[[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]thiophene-2-sulfonamide has a molecular weight of 324.39 g/mol, XLogP of 0.68, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]thiophene-2-sulfonamide is sourced from PubChem (CID 25315799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).