C25H31F3N5P — CID 25318604
(3R,4E)-N,N-diethyl-2-methyl-3-[3-(trifluoromethyl)phenyl]imino-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-amine (PubChem CID 25318604) has the molecular formula C25H31F3N5P and a molecular weight of 489.53 g/mol. Its IUPAC name is (3R,4E)-N,N-diethyl-2-methyl-3-[3-(trifluoromethyl)phenyl]imino-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-amine.
| Compound Name | (3R,4E)-N,N-diethyl-2-methyl-3-[3-(trifluoromethyl)phenyl]imino-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-amine |
|---|---|
| PubChem CID | 25318604 |
| Molecular Formula | C25H31F3N5P |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | (3R,4E)-N,N-diethyl-2-methyl-3-[3-(trifluoromethyl)phenyl]imino-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-amine |
| SMILES | CCN(CC)[P@]1(=Nc2cccc(C(F)(F)F)c2)/C(=C2/N(C)c3ccccc3C2(C)C)C=NN1C |
| InChI | InChI=1S/C25H31F3N5P/c1-7-33(8-2)34(30-19-13-11-12-18(16-19)25(26,27)28)22(17-29-32(34)6)23-24(3,4)20-14-9-10-15-21(20)31(23)5/h9-17H,7-8H2,1-6H3/b23-22+/t34-/m0/s1 |
| InChIKey | NRNWXEVVBOYDLB-VEJILBAHSA-N |
| XLogP | 7.28 |
| TPSA | 34.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|