C19H25N2O4+ — CID 2531888
2,2-dimethoxyethyl-[2-oxo-2-(4-phenylmethoxyanilino)ethyl]azanium (PubChem CID 2531888) has the molecular formula C19H25N2O4+ and a molecular weight of 345.42 g/mol. Its IUPAC name is 2,2-dimethoxyethyl-[2-oxo-2-(4-phenylmethoxyanilino)ethyl]azanium.
| Compound Name | 2,2-dimethoxyethyl-[2-oxo-2-(4-phenylmethoxyanilino)ethyl]azanium |
|---|---|
| PubChem CID | 2531888 |
| Molecular Formula | C19H25N2O4+ |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 2,2-dimethoxyethyl-[2-oxo-2-(4-phenylmethoxyanilino)ethyl]azanium |
| SMILES | COC(C[NH2+]CC(=O)Nc1ccc(OCc2ccccc2)cc1)OC |
| InChI | InChI=1S/C19H24N2O4/c1-23-19(24-2)13-20-12-18(22)21-16-8-10-17(11-9-16)25-14-15-6-4-3-5-7-15/h3-11,19-20H,12-14H2,1-2H3,(H,21,22)/p+1 |
| InChIKey | BNBDRFFHIGFTOS-UHFFFAOYSA-O |
| XLogP | 1.39 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|