C25H31N3O4S — CID 25319384
3-butoxy-N-(5-methoxy-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)benzamide (PubChem CID 25319384) has the molecular formula C25H31N3O4S and a molecular weight of 469.61 g/mol. Its IUPAC name is 3-butoxy-N-(5-methoxy-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | 3-butoxy-N-(5-methoxy-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 25319384 |
| Molecular Formula | C25H31N3O4S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 3-butoxy-N-(5-methoxy-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)benzamide |
| SMILES | CCCCOc1cccc(C(=O)N(CCN2CCOCC2)c2nc3cc(OC)ccc3s2)c1 |
| InChI | InChI=1S/C25H31N3O4S/c1-3-4-14-32-21-7-5-6-19(17-21)24(29)28(11-10-27-12-15-31-16-13-27)25-26-22-18-20(30-2)8-9-23(22)33-25/h5-9,17-18H,3-4,10-16H2,1-2H3 |
| InChIKey | SQYGHNDRIRNGII-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|