C20H31O3- — CID 25321064
(5Z,8Z,11Z,14Z,18R)-18-hydroxyicosa-5,8,11,14-tetraenoate (PubChem CID 25321064) has the molecular formula C20H31O3- and a molecular weight of 319.47 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z,18R)-18-hydroxyicosa-5,8,11,14-tetraenoate.
| Compound Name | (5Z,8Z,11Z,14Z,18R)-18-hydroxyicosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 25321064 |
| Molecular Formula | C20H31O3- |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | (5Z,8Z,11Z,14Z,18R)-18-hydroxyicosa-5,8,11,14-tetraenoate |
| SMILES | CC[C@@H](O)CC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)[O-] |
| InChI | InChI=1S/C20H32O3/c1-2-19(21)17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20(22)23/h4-7,10-13,19,21H,2-3,8-9,14-18H2,1H3,(H,22,23)/p-1/b6-4-,7-5-,12-10-,13-11-/t19-/m1/s1 |
| InChIKey | PPCHNRUZQWLEMF-LFFPGIGVSA-M |
| XLogP | 3.85 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|