C25H23ClN2O4 — CID 2532185
2-(4-benzoylphenoxy)-N-(5-chloro-2-morpholin-4-ylphenyl)acetamide (PubChem CID 2532185) has the molecular formula C25H23ClN2O4 and a molecular weight of 450.92 g/mol. Its IUPAC name is 2-(4-benzoylphenoxy)-N-(5-chloro-2-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-(4-benzoylphenoxy)-N-(5-chloro-2-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 2532185 |
| Molecular Formula | C25H23ClN2O4 |
| Molecular Weight | 450.92 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 2-(4-benzoylphenoxy)-N-(5-chloro-2-morpholin-4-ylphenyl)acetamide |
| SMILES | O=C(COc1ccc(C(=O)c2ccccc2)cc1)Nc1cc(Cl)ccc1N1CCOCC1 |
| InChI | InChI=1S/C25H23ClN2O4/c26-20-8-11-23(28-12-14-31-15-13-28)22(16-20)27-24(29)17-32-21-9-6-19(7-10-21)25(30)18-4-2-1-3-5-18/h1-11,16H,12-15,17H2,(H,27,29) |
| InChIKey | CRJAWJUTEVCIBS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.92 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |