C13H14N3+ — CID 25323014
(1R,12S)-5,8-diaza-14-azoniatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaene (PubChem CID 25323014) has the molecular formula C13H14N3+ and a molecular weight of 212.28 g/mol. Its IUPAC name is (1R,12S)-5,8-diaza-14-azoniatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaene.
| Compound Name | (1R,12S)-5,8-diaza-14-azoniatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaene |
|---|---|
| PubChem CID | 25323014 |
| Molecular Formula | C13H14N3+ |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | (1R,12S)-5,8-diaza-14-azoniatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaene |
| SMILES | c1cnc2cc3c(cc2n1)[C@@H]1C[NH2+]C[C@H]3C1 |
| InChI | InChI=1S/C13H13N3/c1-2-16-13-5-11-9-3-8(6-14-7-9)10(11)4-12(13)15-1/h1-2,4-5,8-9,14H,3,6-7H2/p+1/t8-,9+ |
| InChIKey | JQSHBVHOMNKWFT-DTORHVGOSA-O |
| XLogP | 0.78 |
| TPSA | 42.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |