C14H11N3OS2 — CID 2532337
N-naphthalen-1-yl-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetamide (PubChem CID 2532337) has the molecular formula C14H11N3OS2 and a molecular weight of 301.40 g/mol. Its IUPAC name is N-naphthalen-1-yl-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetamide.
| Compound Name | N-naphthalen-1-yl-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 2532337 |
| Molecular Formula | C14H11N3OS2 |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | N-naphthalen-1-yl-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetamide |
| SMILES | O=C(CSc1nncs1)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C14H11N3OS2/c18-13(8-19-14-17-15-9-20-14)16-12-7-3-5-10-4-1-2-6-11(10)12/h1-7,9H,8H2,(H,16,18) |
| InChIKey | HKRHWUXZEGQQFT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |