C20H21N3O2 — CID 25324083
2-[4-[(2S)-3-(2-ethylbenzimidazol-1-yl)-2-hydroxypropoxy]phenyl]acetonitrile (PubChem CID 25324083) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 2-[4-[(2S)-3-(2-ethylbenzimidazol-1-yl)-2-hydroxypropoxy]phenyl]acetonitrile.
| Compound Name | 2-[4-[(2S)-3-(2-ethylbenzimidazol-1-yl)-2-hydroxypropoxy]phenyl]acetonitrile |
|---|---|
| PubChem CID | 25324083 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 2-[4-[(2S)-3-(2-ethylbenzimidazol-1-yl)-2-hydroxypropoxy]phenyl]acetonitrile |
| SMILES | CCc1nc2ccccc2n1C[C@H](O)COc1ccc(CC#N)cc1 |
| InChI | InChI=1S/C20H21N3O2/c1-2-20-22-18-5-3-4-6-19(18)23(20)13-16(24)14-25-17-9-7-15(8-10-17)11-12-21/h3-10,16,24H,2,11,13-14H2,1H3/t16-/m0/s1 |
| InChIKey | OWPJYYILIFFXFN-INIZCTEOSA-N |
| XLogP | 3.10 |
| TPSA | 71.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |