About (1S)-2-chloro-1-(3,4-difluorophenyl)ethanol
(1S)-2-chloro-1-(3,4-difluorophenyl)ethanol (PubChem CID 25324204) has the molecular formula C8H7ClF2O
and a molecular weight of 192.59 g/mol. Its IUPAC name is (1S)-2-chloro-1-(3,4-difluorophenyl)ethanol.
Molecular Properties
| Compound Name | (1S)-2-chloro-1-(3,4-difluorophenyl)ethanol |
| PubChem CID | 25324204 |
| Molecular Formula | C8H7ClF2O |
| Molecular Weight | 192.59 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | (1S)-2-chloro-1-(3,4-difluorophenyl)ethanol |
| SMILES | O[C@H](CCl)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C8H7ClF2O/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,8,12H,4H2/t8-/m1/s1 |
| InChIKey | RYOLLNVCYSUXCP-MRVPVSSYSA-N |
| XLogP | 2.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.59 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (1S)-2-chloro-1-(3,4-difluorophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-2-chloro-1-(3,4-difluorophenyl)ethanol?
The IUPAC name of (1S)-2-chloro-1-(3,4-difluorophenyl)ethanol (CID 25324204) is (1S)-2-chloro-1-(3,4-difluorophenyl)ethanol.
What is the SMILES notation for (1S)-2-chloro-1-(3,4-difluorophenyl)ethanol?
The canonical SMILES for (1S)-2-chloro-1-(3,4-difluorophenyl)ethanol is O[C@H](CCl)c1ccc(F)c(F)c1.
What is the InChIKey of (1S)-2-chloro-1-(3,4-difluorophenyl)ethanol?
The InChIKey is RYOLLNVCYSUXCP-MRVPVSSYSA-N. The full InChI is InChI=1S/C8H7ClF2O/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,8,12H,4H2/t8-/m1/s1.
What are the key properties of (1S)-2-chloro-1-(3,4-difluorophenyl)ethanol?
(1S)-2-chloro-1-(3,4-difluorophenyl)ethanol has a molecular weight of 192.59 g/mol, XLogP of 2.24, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-2-chloro-1-(3,4-difluorophenyl)ethanol is sourced from PubChem (CID 25324204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).