C18H16ClFN4O2S2 — CID 25328716
N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-2-(7-oxo-3-prop-2-enyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-6-yl)acetamide (PubChem CID 25328716) has the molecular formula C18H16ClFN4O2S2 and a molecular weight of 438.94 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-2-(7-oxo-3-prop-2-enyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-6-yl)acetamide.
| Compound Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-2-(7-oxo-3-prop-2-enyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-6-yl)acetamide |
|---|---|
| PubChem CID | 25328716 |
| Molecular Formula | C18H16ClFN4O2S2 |
| Molecular Weight | 438.94 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-2-(7-oxo-3-prop-2-enyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-6-yl)acetamide |
| SMILES | C=CCn1c(=S)sc2c(=O)n(CC(=O)N(C)Cc3c(F)cccc3Cl)cnc21 |
| InChI | InChI=1S/C18H16ClFN4O2S2/c1-3-7-24-16-15(28-18(24)27)17(26)23(10-21-16)9-14(25)22(2)8-11-12(19)5-4-6-13(11)20/h3-6,10H,1,7-9H2,2H3 |
| InChIKey | DZHPKVNGGHMQQO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 60.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.94 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|