C23H27N5O3 — CID 25330819
4-N-(3-cyclohexyloxypropyl)-2-phenylimidazo[1,5-a]pyrimidine-4,8-dicarboxamide (PubChem CID 25330819) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is 4-N-(3-cyclohexyloxypropyl)-2-phenylimidazo[1,5-a]pyrimidine-4,8-dicarboxamide.
| Compound Name | 4-N-(3-cyclohexyloxypropyl)-2-phenylimidazo[1,5-a]pyrimidine-4,8-dicarboxamide |
|---|---|
| PubChem CID | 25330819 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 4-N-(3-cyclohexyloxypropyl)-2-phenylimidazo[1,5-a]pyrimidine-4,8-dicarboxamide |
| SMILES | NC(=O)c1ncn2c(C(=O)NCCCOC3CCCCC3)cc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C23H27N5O3/c24-21(29)20-22-27-18(16-8-3-1-4-9-16)14-19(28(22)15-26-20)23(30)25-12-7-13-31-17-10-5-2-6-11-17/h1,3-4,8-9,14-15,17H,2,5-7,10-13H2,(H2,24,29)(H,25,30) |
| InChIKey | UTJDUPWLKFHXIV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|