About adamantan-2-amine;hydrochloride
adamantan-2-amine;hydrochloride (PubChem CID 25331) has the molecular formula C10H18ClN
and a molecular weight of 187.71 g/mol. Its IUPAC name is adamantan-2-amine;hydrochloride.
Molecular Properties
| Compound Name | adamantan-2-amine;hydrochloride |
| PubChem CID | 25331 |
| Molecular Formula | C10H18ClN |
| Molecular Weight | 187.71 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | adamantan-2-amine;hydrochloride |
| SMILES | Cl.NC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C10H17N.ClH/c11-10-8-2-6-1-7(4-8)5-9(10)3-6;/h6-10H,1-5,11H2;1H |
| InChIKey | WLDWDRZITJEWRJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.71 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze adamantan-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantan-2-amine;hydrochloride?
The IUPAC name of adamantan-2-amine;hydrochloride (CID 25331) is adamantan-2-amine;hydrochloride.
What is the SMILES notation for adamantan-2-amine;hydrochloride?
The canonical SMILES for adamantan-2-amine;hydrochloride is Cl.NC1C2CC3CC(C2)CC1C3.
What is the InChIKey of adamantan-2-amine;hydrochloride?
The InChIKey is WLDWDRZITJEWRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N.ClH/c11-10-8-2-6-1-7(4-8)5-9(10)3-6;/h6-10H,1-5,11H2;1H.
What are the key properties of adamantan-2-amine;hydrochloride?
adamantan-2-amine;hydrochloride has a molecular weight of 187.71 g/mol, XLogP of 2.19, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for adamantan-2-amine;hydrochloride is sourced from PubChem (CID 25331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).