C13H10F6N4O — CID 25331750
N-ethyl-5-(trifluoromethyl)-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carboxamide (PubChem CID 25331750) has the molecular formula C13H10F6N4O and a molecular weight of 352.24 g/mol. Its IUPAC name is N-ethyl-5-(trifluoromethyl)-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carboxamide.
| Compound Name | N-ethyl-5-(trifluoromethyl)-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 25331750 |
| Molecular Formula | C13H10F6N4O |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | N-ethyl-5-(trifluoromethyl)-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carboxamide |
| SMILES | CCNC(=O)c1cnn(-c2ccc(C(F)(F)F)cn2)c1C(F)(F)F |
| InChI | InChI=1S/C13H10F6N4O/c1-2-20-11(24)8-6-22-23(10(8)13(17,18)19)9-4-3-7(5-21-9)12(14,15)16/h3-6H,2H2,1H3,(H,20,24) |
| InChIKey | FVTYOXRPMWURJQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |