About N-(3-methoxyphenyl)-2-[5-(4-methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetamide
N-(3-methoxyphenyl)-2-[5-(4-methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetamide (PubChem CID 2533231) has the molecular formula C25H22N2O2S
and a molecular weight of 414.53 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-2-[5-(4-methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetamide.
Molecular Properties
| Compound Name | N-(3-methoxyphenyl)-2-[5-(4-methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetamide |
| PubChem CID | 2533231 |
| Molecular Formula | C25H22N2O2S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | N-(3-methoxyphenyl)-2-[5-(4-methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetamide |
| SMILES | COc1cccc(NC(=O)Cc2nc(-c3ccccc3)sc2-c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C25H22N2O2S/c1-17-11-13-18(14-12-17)24-22(27-25(30-24)19-7-4-3-5-8-19)16-23(28)26-20-9-6-10-21(15-20)29-2/h3-15H,16H2,1-2H3,(H,26,28) |
| InChIKey | VZACJKLXQJTVFJ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-methoxyphenyl)-2-[5-(4-methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methoxyphenyl)-2-[5-(4-methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetamide?
The IUPAC name of N-(3-methoxyphenyl)-2-[5-(4-methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetamide (CID 2533231) is N-(3-methoxyphenyl)-2-[5-(4-methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetamide.
What is the SMILES notation for N-(3-methoxyphenyl)-2-[5-(4-methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetamide?
The canonical SMILES for N-(3-methoxyphenyl)-2-[5-(4-methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetamide is COc1cccc(NC(=O)Cc2nc(-c3ccccc3)sc2-c2ccc(C)cc2)c1.
What is the InChIKey of N-(3-methoxyphenyl)-2-[5-(4-methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetamide?
The InChIKey is VZACJKLXQJTVFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22N2O2S/c1-17-11-13-18(14-12-17)24-22(27-25(30-24)19-7-4-3-5-8-19)16-23(28)26-20-9-6-10-21(15-20)29-2/h3-15H,16H2,1-2H3,(H,26,28).
What are the key properties of N-(3-methoxyphenyl)-2-[5-(4-methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetamide?
N-(3-methoxyphenyl)-2-[5-(4-methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetamide has a molecular weight of 414.53 g/mol, XLogP of 5.98, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methoxyphenyl)-2-[5-(4-methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetamide is sourced from PubChem (CID 2533231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).