C25H22N2O2 — CID 25332662
10-[2-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]acridin-9-one (PubChem CID 25332662) has the molecular formula C25H22N2O2 and a molecular weight of 382.46 g/mol. Its IUPAC name is 10-[2-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]acridin-9-one.
| Compound Name | 10-[2-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]acridin-9-one |
|---|---|
| PubChem CID | 25332662 |
| Molecular Formula | C25H22N2O2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 10-[2-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]acridin-9-one |
| SMILES | Cc1ccc2c(c1)CCCN2C(=O)Cn1c2ccccc2c(=O)c2ccccc21 |
| InChI | InChI=1S/C25H22N2O2/c1-17-12-13-21-18(15-17)7-6-14-26(21)24(28)16-27-22-10-4-2-8-19(22)25(29)20-9-3-5-11-23(20)27/h2-5,8-13,15H,6-7,14,16H2,1H3 |
| InChIKey | AWLCKFMKEMVFLK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|