C23H23N5O2S — CID 25332813
(3S)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-4-[(2-sulfanylidene-1,3-benzoxazol-3-yl)methyl]piperazin-2-one (PubChem CID 25332813) has the molecular formula C23H23N5O2S and a molecular weight of 433.54 g/mol. Its IUPAC name is (3S)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-4-[(2-sulfanylidene-1,3-benzoxazol-3-yl)methyl]piperazin-2-one.
| Compound Name | (3S)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-4-[(2-sulfanylidene-1,3-benzoxazol-3-yl)methyl]piperazin-2-one |
|---|---|
| PubChem CID | 25332813 |
| Molecular Formula | C23H23N5O2S |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | (3S)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-4-[(2-sulfanylidene-1,3-benzoxazol-3-yl)methyl]piperazin-2-one |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1[C@H]1C(=O)NCCN1Cn1c(=S)oc2ccccc21 |
| InChI | InChI=1S/C23H23N5O2S/c1-15-20(16(2)28(25-15)17-8-4-3-5-9-17)21-22(29)24-12-13-26(21)14-27-18-10-6-7-11-19(18)30-23(27)31/h3-11,21H,12-14H2,1-2H3,(H,24,29)/t21-/m0/s1 |
| InChIKey | XNHCRERRAGUUTF-NRFANRHFSA-N |
| XLogP | 3.90 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|