C21H25N5O3S — CID 25334641
N-[4-[2,4-di(propan-2-yl)phenyl]-1,3-thiazol-2-yl]-3-(4-nitroimidazol-1-yl)propanamide (PubChem CID 25334641) has the molecular formula C21H25N5O3S and a molecular weight of 427.53 g/mol. Its IUPAC name is N-[4-[2,4-di(propan-2-yl)phenyl]-1,3-thiazol-2-yl]-3-(4-nitroimidazol-1-yl)propanamide.
| Compound Name | N-[4-[2,4-di(propan-2-yl)phenyl]-1,3-thiazol-2-yl]-3-(4-nitroimidazol-1-yl)propanamide |
|---|---|
| PubChem CID | 25334641 |
| Molecular Formula | C21H25N5O3S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | N-[4-[2,4-di(propan-2-yl)phenyl]-1,3-thiazol-2-yl]-3-(4-nitroimidazol-1-yl)propanamide |
| SMILES | CC(C)c1ccc(-c2csc(NC(=O)CCn3cnc([N+](=O)[O-])c3)n2)c(C(C)C)c1 |
| InChI | InChI=1S/C21H25N5O3S/c1-13(2)15-5-6-16(17(9-15)14(3)4)18-11-30-21(23-18)24-20(27)7-8-25-10-19(22-12-25)26(28)29/h5-6,9-14H,7-8H2,1-4H3,(H,23,24,27) |
| InChIKey | FEMDTWROPIHSKH-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|