C20H21F3N2O4 — CID 25336231
N-[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]-2-[4-(trifluoromethoxy)anilino]acetamide (PubChem CID 25336231) has the molecular formula C20H21F3N2O4 and a molecular weight of 410.39 g/mol. Its IUPAC name is N-[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]-2-[4-(trifluoromethoxy)anilino]acetamide.
| Compound Name | N-[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]-2-[4-(trifluoromethoxy)anilino]acetamide |
|---|---|
| PubChem CID | 25336231 |
| Molecular Formula | C20H21F3N2O4 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | N-[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]-2-[4-(trifluoromethoxy)anilino]acetamide |
| SMILES | CCOc1cc2c(cc1NC(=O)CNc1ccc(OC(F)(F)F)cc1)O[C@H](C)C2 |
| InChI | InChI=1S/C20H21F3N2O4/c1-3-27-18-9-13-8-12(2)28-17(13)10-16(18)25-19(26)11-24-14-4-6-15(7-5-14)29-20(21,22)23/h4-7,9-10,12,24H,3,8,11H2,1-2H3,(H,25,26)/t12-/m1/s1 |
| InChIKey | IGMUFYXMBQBTJQ-GFCCVEGCSA-N |
| XLogP | 4.36 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|